C25H50O5Si2 — CID 612571
methyl 5-[2-(3-oxooctyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]pentanoate (PubChem CID 612571) has the molecular formula C25H50O5Si2 and a molecular weight of 486.84 g/mol. Its IUPAC name is methyl 5-[2-(3-oxooctyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]pentanoate.
| Compound Name | methyl 5-[2-(3-oxooctyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]pentanoate |
|---|---|
| PubChem CID | 612571 |
| Molecular Formula | C25H50O5Si2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | methyl 5-[2-(3-oxooctyl)-3,5-bis(trimethylsilyloxy)cyclopentyl]pentanoate |
| SMILES | CCCCCC(=O)CCC1C(O[Si](C)(C)C)CC(O[Si](C)(C)C)C1CCCCC(=O)OC |
| InChI | InChI=1S/C25H50O5Si2/c1-9-10-11-14-20(26)17-18-22-21(15-12-13-16-25(27)28-2)23(29-31(3,4)5)19-24(22)30-32(6,7)8/h21-24H,9-19H2,1-8H3 |
| InChIKey | XQZSXMGXOROYAN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|