About 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid
4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 56595949) has the molecular formula C19H14ClNO6S2
and a molecular weight of 451.91 g/mol. Its IUPAC name is 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid |
| PubChem CID | 56595949 |
| Molecular Formula | C19H14ClNO6S2 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2cc(-c3ccc4c(c3)CCO4)c(Cl)s2)cc1O |
| InChI | InChI=1S/C19H14ClNO6S2/c20-18-14(10-1-4-16-11(7-10)5-6-27-16)9-17(28-18)29(25,26)21-12-2-3-13(19(23)24)15(22)8-12/h1-4,7-9,21-22H,5-6H2,(H,23,24) |
| InChIKey | XPYFBTCFUBAQLF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid?
The IUPAC name of 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid (CID 56595949) is 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid.
What is the SMILES notation for 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid?
The canonical SMILES for 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid is O=C(O)c1ccc(NS(=O)(=O)c2cc(-c3ccc4c(c3)CCO4)c(Cl)s2)cc1O.
What is the InChIKey of 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid?
The InChIKey is XPYFBTCFUBAQLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClNO6S2/c20-18-14(10-1-4-16-11(7-10)5-6-27-16)9-17(28-18)29(25,26)21-12-2-3-13(19(23)24)15(22)8-12/h1-4,7-9,21-22H,5-6H2,(H,23,24).
What are the key properties of 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid?
4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid has a molecular weight of 451.91 g/mol, XLogP of 4.21, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-chloro-4-(2,3-dihydro-1-benzofuran-5-yl)thiophen-2-yl]sulfonylamino]-2-hydroxybenzoic acid is sourced from PubChem (CID 56595949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).