C25H17F3N6O — CID 56599113
[1-(6-methoxy-3-pyridinyl)-3-methyl-8-[3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-ylidene]cyanamide (PubChem CID 56599113) has the molecular formula C25H17F3N6O and a molecular weight of 474.45 g/mol. Its IUPAC name is [1-(6-methoxy-3-pyridinyl)-3-methyl-8-[3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-ylidene]cyanamide.
| Compound Name | [1-(6-methoxy-3-pyridinyl)-3-methyl-8-[3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 56599113 |
| Molecular Formula | C25H17F3N6O |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | [1-(6-methoxy-3-pyridinyl)-3-methyl-8-[3-(trifluoromethyl)phenyl]imidazo[4,5-c]quinolin-2-ylidene]cyanamide |
| SMILES | COc1ccc(-n2/c(=N/C#N)n(C)c3cnc4ccc(-c5cccc(C(F)(F)F)c5)cc4c32)cn1 |
| InChI | InChI=1S/C25H17F3N6O/c1-33-21-13-30-20-8-6-16(15-4-3-5-17(10-15)25(26,27)28)11-19(20)23(21)34(24(33)32-14-29)18-7-9-22(35-2)31-12-18/h3-13H,1-2H3/b32-24+ |
| InChIKey | MAPKYDSQRSLUEF-FEZSWGLMSA-N |
| XLogP | 4.99 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|