C24H16F2N6O — CID 87097787
[8-(3,5-difluorophenyl)-1-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-ylidene]cyanamide (PubChem CID 87097787) has the molecular formula C24H16F2N6O and a molecular weight of 442.43 g/mol. Its IUPAC name is [8-(3,5-difluorophenyl)-1-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-ylidene]cyanamide.
| Compound Name | [8-(3,5-difluorophenyl)-1-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 87097787 |
| Molecular Formula | C24H16F2N6O |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [8-(3,5-difluorophenyl)-1-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-ylidene]cyanamide |
| SMILES | COc1ccc(-n2/c(=N/C#N)n(C)c3cnc4ccc(-c5cc(F)cc(F)c5)cc4c32)cn1 |
| InChI | InChI=1S/C24H16F2N6O/c1-31-21-12-28-20-5-3-14(15-7-16(25)10-17(26)8-15)9-19(20)23(21)32(24(31)30-13-27)18-4-6-22(33-2)29-11-18/h3-12H,1-2H3/b30-24+ |
| InChIKey | IOJMYUVDHFSJAV-BGABXYSRSA-N |
| XLogP | 4.25 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|