C18H13BrN6O — CID 86683441
[8-bromo-1-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-ylidene]cyanamide (PubChem CID 86683441) has the molecular formula C18H13BrN6O and a molecular weight of 409.25 g/mol. Its IUPAC name is [8-bromo-1-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-ylidene]cyanamide.
| Compound Name | [8-bromo-1-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 86683441 |
| Molecular Formula | C18H13BrN6O |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | [8-bromo-1-(6-methoxy-3-pyridinyl)-3-methylimidazo[4,5-c]quinolin-2-ylidene]cyanamide |
| SMILES | COc1ccc(-n2/c(=N/C#N)n(C)c3cnc4ccc(Br)cc4c32)cn1 |
| InChI | InChI=1S/C18H13BrN6O/c1-24-15-9-21-14-5-3-11(19)7-13(14)17(15)25(18(24)23-10-20)12-4-6-16(26-2)22-8-12/h3-9H,1-2H3/b23-18+ |
| InChIKey | XBWXNRADGJCOEQ-PTGBLXJZSA-N |
| XLogP | 3.07 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|