C26H29FN6O4 — CID 56599592
(Z)-but-2-enedioic acid;6-N-[(1S)-1-(4-fluorophenyl)ethyl]-4-piperidin-3-yl-2-N-pyrazin-2-ylpyridine-2,6-diamine (PubChem CID 56599592) has the molecular formula C26H29FN6O4 and a molecular weight of 508.55 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;6-N-[(1S)-1-(4-fluorophenyl)ethyl]-4-piperidin-3-yl-2-N-pyrazin-2-ylpyridine-2,6-diamine.
| Compound Name | (Z)-but-2-enedioic acid;6-N-[(1S)-1-(4-fluorophenyl)ethyl]-4-piperidin-3-yl-2-N-pyrazin-2-ylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 56599592 |
| Molecular Formula | C26H29FN6O4 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;6-N-[(1S)-1-(4-fluorophenyl)ethyl]-4-piperidin-3-yl-2-N-pyrazin-2-ylpyridine-2,6-diamine |
| SMILES | C[C@H](Nc1cc(C2CCCNC2)cc(Nc2cnccn2)n1)c1ccc(F)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C22H25FN6.C4H4O4/c1-15(16-4-6-19(23)7-5-16)27-20-11-18(17-3-2-8-24-13-17)12-21(28-20)29-22-14-25-9-10-26-22;5-3(6)1-2-4(7)8/h4-7,9-12,14-15,17,24H,2-3,8,13H2,1H3,(H2,26,27,28,29);1-2H,(H,5,6)(H,7,8)/b;2-1-/t15-,17?;/m0./s1 |
| InChIKey | JFTIYWXGJNVXKG-AOSNFOGGSA-N |
| XLogP | 4.11 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|