C16H18N4O3 — CID 56599637
benzyl N-[(S)-(hydrazinecarbonylamino)-phenylmethyl]carbamate (PubChem CID 56599637) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is benzyl N-[(S)-(hydrazinecarbonylamino)-phenylmethyl]carbamate.
| Compound Name | benzyl N-[(S)-(hydrazinecarbonylamino)-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 56599637 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | benzyl N-[(S)-(hydrazinecarbonylamino)-phenylmethyl]carbamate |
| SMILES | NNC(=O)N[C@@H](NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N4O3/c17-20-15(21)18-14(13-9-5-2-6-10-13)19-16(22)23-11-12-7-3-1-4-8-12/h1-10,14H,11,17H2,(H,19,22)(H2,18,20,21)/t14-/m0/s1 |
| InChIKey | LIBUJDJHHVVDRR-AWEZNQCLSA-N |
| XLogP | 1.78 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|