C22H29N4O3P — CID 56600246
ethyl (3E)-2-[3-aminopropyl(diphenyl)-λ5-phosphanylidene]-3-(carbamoylhydrazinylidene)butanoate (PubChem CID 56600246) has the molecular formula C22H29N4O3P and a molecular weight of 428.47 g/mol. Its IUPAC name is ethyl (3E)-2-[3-aminopropyl(diphenyl)-λ5-phosphanylidene]-3-(carbamoylhydrazinylidene)butanoate.
| Compound Name | ethyl (3E)-2-[3-aminopropyl(diphenyl)-λ5-phosphanylidene]-3-(carbamoylhydrazinylidene)butanoate |
|---|---|
| PubChem CID | 56600246 |
| Molecular Formula | C22H29N4O3P |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | ethyl (3E)-2-[3-aminopropyl(diphenyl)-λ5-phosphanylidene]-3-(carbamoylhydrazinylidene)butanoate |
| SMILES | CCOC(=O)C(/C(C)=N/NC(N)=O)=P(CCCN)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29N4O3P/c1-3-29-21(27)20(17(2)25-26-22(24)28)30(16-10-15-23,18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14H,3,10,15-16,23H2,1-2H3,(H3,24,26,28)/b25-17+ |
| InChIKey | QJVLVPMHSIMQQY-KOEQRZSOSA-N |
| XLogP | 1.78 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|