C29H24ClN3O7 — CID 56600437
2-[(19S)-10-ethyl-19-hydroxy-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl]ethyl 6-chloropyridine-3-carboxylate (PubChem CID 56600437) has the molecular formula C29H24ClN3O7 and a molecular weight of 561.98 g/mol. Its IUPAC name is 2-[(19S)-10-ethyl-19-hydroxy-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl]ethyl 6-chloropyridine-3-carboxylate.
| Compound Name | 2-[(19S)-10-ethyl-19-hydroxy-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl]ethyl 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 56600437 |
| Molecular Formula | C29H24ClN3O7 |
| Molecular Weight | 561.98 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 2-[(19S)-10-ethyl-19-hydroxy-7-methoxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl]ethyl 6-chloropyridine-3-carboxylate |
| SMILES | CCc1c2c(nc3ccc(OC)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CCOC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C29H24ClN3O7/c1-3-17-18-10-16(38-2)5-6-22(18)32-25-19(17)13-33-23(25)11-21-20(26(33)34)14-40-28(36)29(21,37)8-9-39-27(35)15-4-7-24(30)31-12-15/h4-7,10-12,37H,3,8-9,13-14H2,1-2H3/t29-/m0/s1 |
| InChIKey | CATKTKHASGXMRQ-LJAQVGFWSA-N |
| XLogP | 3.54 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.98 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|