C24H22F3N3O4 — CID 56600536
6-(2,6-difluorophenyl)-N-[4-[(2R,3S,4R,5S,6R)-4,5-dihydroxy-3,6-dimethyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide (PubChem CID 56600536) has the molecular formula C24H22F3N3O4 and a molecular weight of 473.45 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-N-[4-[(2R,3S,4R,5S,6R)-4,5-dihydroxy-3,6-dimethyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | 6-(2,6-difluorophenyl)-N-[4-[(2R,3S,4R,5S,6R)-4,5-dihydroxy-3,6-dimethyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 56600536 |
| Molecular Formula | C24H22F3N3O4 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 6-(2,6-difluorophenyl)-N-[4-[(2R,3S,4R,5S,6R)-4,5-dihydroxy-3,6-dimethyloxan-2-yl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1[C@@H](O)[C@H](O)[C@@H](C)O[C@H]1c1ccncc1NC(=O)c1ccc(F)c(-c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C24H22F3N3O4/c1-11-21(31)22(32)12(2)34-23(11)13-8-9-28-10-18(13)30-24(33)17-7-6-16(27)20(29-17)19-14(25)4-3-5-15(19)26/h3-12,21-23,31-32H,1-2H3,(H,30,33)/t11-,12+,21+,22+,23+/m0/s1 |
| InChIKey | KFJVVUDXCFZCHT-PTMUDDDTSA-N |
| XLogP | 3.63 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |