C15H23NO — CID 56600814
(3R,5R,8R,8aR)-3-ethenyl-8-methyl-5-(2-methylprop-2-enyl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one (PubChem CID 56600814) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (3R,5R,8R,8aR)-3-ethenyl-8-methyl-5-(2-methylprop-2-enyl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one.
| Compound Name | (3R,5R,8R,8aR)-3-ethenyl-8-methyl-5-(2-methylprop-2-enyl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one |
|---|---|
| PubChem CID | 56600814 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (3R,5R,8R,8aR)-3-ethenyl-8-methyl-5-(2-methylprop-2-enyl)-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one |
| SMILES | C=C[C@H]1CC[C@@H]2[C@@H](C)C(=O)C[C@@H](CC(=C)C)N21 |
| InChI | InChI=1S/C15H23NO/c1-5-12-6-7-14-11(4)15(17)9-13(16(12)14)8-10(2)3/h5,11-14H,1-2,6-9H2,3-4H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | ZFBYYYXDKKMREU-XJFOESAGSA-N |
| XLogP | 2.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|