C13H21NO — CID 101260107
(5R,8aS)-5-tert-butyl-2-methylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one (PubChem CID 101260107) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (5R,8aS)-5-tert-butyl-2-methylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one.
| Compound Name | (5R,8aS)-5-tert-butyl-2-methylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one |
|---|---|
| PubChem CID | 101260107 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (5R,8aS)-5-tert-butyl-2-methylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one |
| SMILES | C=C1C[C@H]2CC(=O)C[C@H](C(C)(C)C)N2C1 |
| InChI | InChI=1S/C13H21NO/c1-9-5-10-6-11(15)7-12(13(2,3)4)14(10)8-9/h10,12H,1,5-8H2,2-4H3/t10-,12+/m0/s1 |
| InChIKey | SHEMUTICBAKHFP-CMPLNLGQSA-N |
| XLogP | 2.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|