C12H17NO — CID 11708200
(1R,7S,8R)-7-methyl-2-methylidene-4-azatricyclo[5.2.2.04,8]undecan-10-one (PubChem CID 11708200) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (1R,7S,8R)-7-methyl-2-methylidene-4-azatricyclo[5.2.2.04,8]undecan-10-one.
| Compound Name | (1R,7S,8R)-7-methyl-2-methylidene-4-azatricyclo[5.2.2.04,8]undecan-10-one |
|---|---|
| PubChem CID | 11708200 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (1R,7S,8R)-7-methyl-2-methylidene-4-azatricyclo[5.2.2.04,8]undecan-10-one |
| SMILES | C=C1CN2CC[C@@]3(C)CC(=O)[C@@H]1C[C@@H]23 |
| InChI | InChI=1S/C12H17NO/c1-8-7-13-4-3-12(2)6-10(14)9(8)5-11(12)13/h9,11H,1,3-7H2,2H3/t9-,11-,12+/m1/s1 |
| InChIKey | WGYNQTULODFFRT-JLLWLGSASA-N |
| XLogP | 1.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|