C21H22N2O3 — CID 56601360
7-[3-(cyclopropanecarbonylamino)phenyl]-N-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 56601360) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 7-[3-(cyclopropanecarbonylamino)phenyl]-N-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | 7-[3-(cyclopropanecarbonylamino)phenyl]-N-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 56601360 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 7-[3-(cyclopropanecarbonylamino)phenyl]-N-hydroxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NO)C1CCc2ccc(-c3cccc(NC(=O)C4CC4)c3)cc2C1 |
| InChI | InChI=1S/C21H22N2O3/c24-20(14-6-7-14)22-19-3-1-2-15(12-19)16-8-4-13-5-9-17(21(25)23-26)11-18(13)10-16/h1-4,8,10,12,14,17,26H,5-7,9,11H2,(H,22,24)(H,23,25) |
| InChIKey | JDECRIHRHWCHRI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|