C19H18N2O2 — CID 58055322
N-hydroxy-7-(1H-indol-3-yl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 58055322) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-hydroxy-7-(1H-indol-3-yl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-hydroxy-7-(1H-indol-3-yl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58055322 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-hydroxy-7-(1H-indol-3-yl)-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NO)C1CCc2ccc(-c3c[nH]c4ccccc34)cc2C1 |
| InChI | InChI=1S/C19H18N2O2/c22-19(21-23)14-8-6-12-5-7-13(9-15(12)10-14)17-11-20-18-4-2-1-3-16(17)18/h1-5,7,9,11,14,20,23H,6,8,10H2,(H,21,22) |
| InChIKey | YMQWOQHENSUUFI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|