C16H15F3N4O2 — CID 56603841
N,N-bis(prop-2-enyl)-4-[4-(trifluoromethoxy)phenyl]triazole-2-carboxamide (PubChem CID 56603841) has the molecular formula C16H15F3N4O2 and a molecular weight of 352.32 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-4-[4-(trifluoromethoxy)phenyl]triazole-2-carboxamide.
| Compound Name | N,N-bis(prop-2-enyl)-4-[4-(trifluoromethoxy)phenyl]triazole-2-carboxamide |
|---|---|
| PubChem CID | 56603841 |
| Molecular Formula | C16H15F3N4O2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N,N-bis(prop-2-enyl)-4-[4-(trifluoromethoxy)phenyl]triazole-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)n1ncc(-c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C16H15F3N4O2/c1-3-9-22(10-4-2)15(24)23-20-11-14(21-23)12-5-7-13(8-6-12)25-16(17,18)19/h3-8,11H,1-2,9-10H2 |
| InChIKey | JXERPXCNOADUTE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|