C11H11Br2N3 — CID 56604593
3,5-dibromo-1-(3-phenylpropyl)-1,2,4-triazole (PubChem CID 56604593) has the molecular formula C11H11Br2N3 and a molecular weight of 345.04 g/mol. Its IUPAC name is 3,5-dibromo-1-(3-phenylpropyl)-1,2,4-triazole.
| Compound Name | 3,5-dibromo-1-(3-phenylpropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 56604593 |
| Molecular Formula | C11H11Br2N3 |
| Molecular Weight | 345.04 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | 3,5-dibromo-1-(3-phenylpropyl)-1,2,4-triazole |
| SMILES | Brc1nc(Br)n(CCCc2ccccc2)n1 |
| InChI | InChI=1S/C11H11Br2N3/c12-10-14-11(13)16(15-10)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | ABFBVOCACDEGEK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.04 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |