C21H24BrIO2 — CID 56607264
(6R,8R,9S,10S,13S,14S)-6-bromo-10-(3-iodoprop-2-ynyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 56607264) has the molecular formula C21H24BrIO2 and a molecular weight of 515.23 g/mol. Its IUPAC name is (6R,8R,9S,10S,13S,14S)-6-bromo-10-(3-iodoprop-2-ynyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (6R,8R,9S,10S,13S,14S)-6-bromo-10-(3-iodoprop-2-ynyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 56607264 |
| Molecular Formula | C21H24BrIO2 |
| Molecular Weight | 515.23 g/mol |
| Exact Mass | 514.00 |
| IUPAC Name | (6R,8R,9S,10S,13S,14S)-6-bromo-10-(3-iodoprop-2-ynyl)-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC[C@H]3[C@@H](C[C@@H](Br)C4=CC(=O)CC[C@@]43CC#CI)[C@@H]1CCC2=O |
| InChI | InChI=1S/C21H24BrIO2/c1-20-8-6-16-14(15(20)3-4-19(20)25)12-18(22)17-11-13(24)5-9-21(16,17)7-2-10-23/h11,14-16,18H,3-9,12H2,1H3/t14-,15-,16-,18+,20-,21+/m0/s1 |
| InChIKey | KBTNLGRAJGKEAL-AKLANTLKSA-N |
| XLogP | 5.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.23 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|