C23H22N4O9S2 — CID 56609098
(2S,5R,6R)-2-formamido-3,3-dimethyl-6-[[3-[(4-nitrophenyl)methoxy]-3-oxo-2-thiophen-3-ylpropanoyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 56609098) has the molecular formula C23H22N4O9S2 and a molecular weight of 562.58 g/mol. Its IUPAC name is (2S,5R,6R)-2-formamido-3,3-dimethyl-6-[[3-[(4-nitrophenyl)methoxy]-3-oxo-2-thiophen-3-ylpropanoyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-2-formamido-3,3-dimethyl-6-[[3-[(4-nitrophenyl)methoxy]-3-oxo-2-thiophen-3-ylpropanoyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 56609098 |
| Molecular Formula | C23H22N4O9S2 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | (2S,5R,6R)-2-formamido-3,3-dimethyl-6-[[3-[(4-nitrophenyl)methoxy]-3-oxo-2-thiophen-3-ylpropanoyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)C(C(=O)OCc3ccc([N+](=O)[O-])cc3)c3ccsc3)C(=O)N2[C@@]1(NC=O)C(=O)O |
| InChI | InChI=1S/C23H22N4O9S2/c1-22(2)23(21(32)33,24-11-28)26-18(30)16(19(26)38-22)25-17(29)15(13-7-8-37-10-13)20(31)36-9-12-3-5-14(6-4-12)27(34)35/h3-8,10-11,15-16,19H,9H2,1-2H3,(H,24,28)(H,25,29)(H,32,33)/t15?,16-,19-,23+/m1/s1 |
| InChIKey | TYPUGWRGXDVYOE-CJJVQQSWSA-N |
| XLogP | 1.19 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|