C23H24N4O7S2 — CID 54172548
(4-nitrophenyl)methyl (6S)-7-[(2-amino-2-thiophen-3-ylacetyl)amino]-3-(ethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54172548) has the molecular formula C23H24N4O7S2 and a molecular weight of 532.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-7-[(2-amino-2-thiophen-3-ylacetyl)amino]-3-(ethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-7-[(2-amino-2-thiophen-3-ylacetyl)amino]-3-(ethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54172548 |
| Molecular Formula | C23H24N4O7S2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-7-[(2-amino-2-thiophen-3-ylacetyl)amino]-3-(ethoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCOCC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C(NC(=O)C(N)c3ccsc3)[C@@H]2SC1 |
| InChI | InChI=1S/C23H24N4O7S2/c1-2-33-10-15-12-36-22-18(25-20(28)17(24)14-7-8-35-11-14)21(29)26(22)19(15)23(30)34-9-13-3-5-16(6-4-13)27(31)32/h3-8,11,17-18,22H,2,9-10,12,24H2,1H3,(H,25,28)/t17?,18?,22-/m0/s1 |
| InChIKey | OWASXUNPXASQDA-IRZJEQJZSA-N |
| XLogP | 2.09 |
| TPSA | 154.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|