C8H14N2O2S — CID 56609593
2-(2-prop-2-enylsulfanylethyldiazenyl)propanoic acid (PubChem CID 56609593) has the molecular formula C8H14N2O2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-(2-prop-2-enylsulfanylethyldiazenyl)propanoic acid.
| Compound Name | 2-(2-prop-2-enylsulfanylethyldiazenyl)propanoic acid |
|---|---|
| PubChem CID | 56609593 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-(2-prop-2-enylsulfanylethyldiazenyl)propanoic acid |
| SMILES | C=CCSCC/N=N/C(C)C(=O)O |
| InChI | InChI=1S/C8H14N2O2S/c1-3-5-13-6-4-9-10-7(2)8(11)12/h3,7H,1,4-6H2,2H3,(H,11,12)/b10-9+ |
| InChIKey | MFECTZCDVNXNDD-MDZDMXLPSA-N |
| XLogP | 1.83 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|