C25H31NO6 — CID 56609671
1-(3,4-dimethoxyphenyl)-6-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)hexane-1,6-dione (PubChem CID 56609671) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-6-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)hexane-1,6-dione.
| Compound Name | 1-(3,4-dimethoxyphenyl)-6-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 56609671 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-6-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)hexane-1,6-dione |
| SMILES | COc1ccc(C(=O)CCCCC(=O)C2NCCc3cc(OC)c(OC)cc32)cc1OC |
| InChI | InChI=1S/C25H31NO6/c1-29-21-10-9-17(14-22(21)30-2)19(27)7-5-6-8-20(28)25-18-15-24(32-4)23(31-3)13-16(18)11-12-26-25/h9-10,13-15,25-26H,5-8,11-12H2,1-4H3 |
| InChIKey | PDBDJBPSAGBHEB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|