C23H32 — CID 56612113
1-(3-phenylpentan-3-yl)-3,5-di(propan-2-yl)benzene (PubChem CID 56612113) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-(3-phenylpentan-3-yl)-3,5-di(propan-2-yl)benzene.
| Compound Name | 1-(3-phenylpentan-3-yl)-3,5-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 56612113 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 1-(3-phenylpentan-3-yl)-3,5-di(propan-2-yl)benzene |
| SMILES | CCC(CC)(c1ccccc1)c1cc(C(C)C)cc(C(C)C)c1 |
| InChI | InChI=1S/C23H32/c1-7-23(8-2,21-12-10-9-11-13-21)22-15-19(17(3)4)14-20(16-22)18(5)6/h9-18H,7-8H2,1-6H3 |
| InChIKey | KXEPRGLTAWQNFJ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |