C27H35O4- — CID 91934336
(E,3R,5S)-3,5-dihydroxy-7-[4-(3-phenylpentan-3-yl)-2-propan-2-ylphenyl]hept-6-enoate (PubChem CID 91934336) has the molecular formula C27H35O4- and a molecular weight of 423.57 g/mol. Its IUPAC name is (E,3R,5S)-3,5-dihydroxy-7-[4-(3-phenylpentan-3-yl)-2-propan-2-ylphenyl]hept-6-enoate.
| Compound Name | (E,3R,5S)-3,5-dihydroxy-7-[4-(3-phenylpentan-3-yl)-2-propan-2-ylphenyl]hept-6-enoate |
|---|---|
| PubChem CID | 91934336 |
| Molecular Formula | C27H35O4- |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | (E,3R,5S)-3,5-dihydroxy-7-[4-(3-phenylpentan-3-yl)-2-propan-2-ylphenyl]hept-6-enoate |
| SMILES | CCC(CC)(c1ccccc1)c1ccc(/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])c(C(C)C)c1 |
| InChI | InChI=1S/C27H36O4/c1-5-27(6-2,21-10-8-7-9-11-21)22-14-12-20(25(16-22)19(3)4)13-15-23(28)17-24(29)18-26(30)31/h7-16,19,23-24,28-29H,5-6,17-18H2,1-4H3,(H,30,31)/p-1/b15-13+/t23-,24-/m1/s1 |
| InChIKey | KXGCCVVMZLNEPZ-ZUYUJVNMSA-M |
| XLogP | 4.18 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |