C6H12N2 — CID 566122
3,4,5-trimethyl-4,5-dihydro-1H-pyrazole (PubChem CID 566122) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 3,4,5-trimethyl-4,5-dihydro-1H-pyrazole.
| Compound Name | 3,4,5-trimethyl-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 566122 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 3,4,5-trimethyl-4,5-dihydro-1H-pyrazole |
| SMILES | CC1=NNC(C)C1C |
| InChI | InChI=1S/C6H12N2/c1-4-5(2)7-8-6(4)3/h4-5,7H,1-3H3 |
| InChIKey | NBUOBRBXCTZHFM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |