C39H24F6N2O6 — CID 56612456
2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 56612456) has the molecular formula C39H24F6N2O6 and a molecular weight of 730.62 g/mol. Its IUPAC name is 2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 56612456 |
| Molecular Formula | C39H24F6N2O6 |
| Molecular Weight | 730.62 g/mol |
| Exact Mass | 730.15 |
| IUPAC Name | 2-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]-6-methylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(-n5c(=O)c6cc7c(=O)n(C)c(=O)c7cc6c5=O)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C39H24F6N2O6/c1-21-3-11-25(12-4-21)52-26-13-5-22(6-14-26)37(38(40,41)42,39(43,44)45)23-7-15-27(16-8-23)53-28-17-9-24(10-18-28)47-35(50)31-19-29-30(20-32(31)36(47)51)34(49)46(2)33(29)48/h3-20H,1-2H3 |
| InChIKey | IFVIIKOHRWQQCT-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.62 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |