C39H27F3N2O6 — CID 56617366
6-methyl-2-[4-[4-[1,1,1-trifluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 56617366) has the molecular formula C39H27F3N2O6 and a molecular weight of 676.65 g/mol. Its IUPAC name is 6-methyl-2-[4-[4-[1,1,1-trifluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 6-methyl-2-[4-[4-[1,1,1-trifluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 56617366 |
| Molecular Formula | C39H27F3N2O6 |
| Molecular Weight | 676.65 g/mol |
| Exact Mass | 676.18 |
| IUPAC Name | 6-methyl-2-[4-[4-[1,1,1-trifluoro-2-[4-(4-methylphenoxy)phenyl]propan-2-yl]phenoxy]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(Oc2ccc(C(C)(c3ccc(Oc4ccc(-n5c(=O)c6cc7c(=O)n(C)c(=O)c7cc6c5=O)cc4)cc3)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C39H27F3N2O6/c1-22-4-12-26(13-5-22)49-27-14-6-23(7-15-27)38(2,39(40,41)42)24-8-16-28(17-9-24)50-29-18-10-25(11-19-29)44-36(47)32-20-30-31(21-33(32)37(44)48)35(46)43(3)34(30)45/h4-21H,1-3H3 |
| InChIKey | VMLGJFRMSKRACV-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.65 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |