C14H25NO11 — CID 56619494
N-[(2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxo-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexan-2-yl]acetamide (PubChem CID 56619494) has the molecular formula C14H25NO11 and a molecular weight of 383.35 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxo-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexan-2-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxo-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexan-2-yl]acetamide |
|---|---|
| PubChem CID | 56619494 |
| Molecular Formula | C14H25NO11 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[(2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxo-3-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]hexan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C=O)[C@](O)(C1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H25NO11/c1-5(19)15-8(4-18)14(25,12(24)6(20)2-16)13-11(23)10(22)9(21)7(3-17)26-13/h4,6-13,16-17,20-25H,2-3H2,1H3,(H,15,19)/t6-,7-,8+,9+,10+,11-,12-,13?,14-/m1/s1 |
| InChIKey | FOWRXXSGAMPHKN-ZCGBBGKTSA-N |
| XLogP | -6.02 |
| TPSA | 217.24 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | -6.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|