C18H25N3O2 — CID 56620094
(4R,5S)-5-azido-4-oct-1-enyl-2-phenyl-1,3-dioxane (PubChem CID 56620094) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (4R,5S)-5-azido-4-oct-1-enyl-2-phenyl-1,3-dioxane.
| Compound Name | (4R,5S)-5-azido-4-oct-1-enyl-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 56620094 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (4R,5S)-5-azido-4-oct-1-enyl-2-phenyl-1,3-dioxane |
| SMILES | CCCCCCC=C[C@H]1OC(c2ccccc2)OC[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C18H25N3O2/c1-2-3-4-5-6-10-13-17-16(20-21-19)14-22-18(23-17)15-11-8-7-9-12-15/h7-13,16-18H,2-6,14H2,1H3/t16-,17+,18?/m0/s1 |
| InChIKey | NCTFCAQYBJUSHV-MYFVLZFPSA-N |
| XLogP | 5.31 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|