C26H36O7 — CID 56620300
[2-[(1S,2S,10S,11S,14S,15S,17S)-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-14-yl]-2-oxoethyl] 2-(ethoxymethoxy)acetate (PubChem CID 56620300) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is [2-[(1S,2S,10S,11S,14S,15S,17S)-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-14-yl]-2-oxoethyl] 2-(ethoxymethoxy)acetate.
| Compound Name | [2-[(1S,2S,10S,11S,14S,15S,17S)-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-14-yl]-2-oxoethyl] 2-(ethoxymethoxy)acetate |
|---|---|
| PubChem CID | 56620300 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [2-[(1S,2S,10S,11S,14S,15S,17S)-2,15-dimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-en-14-yl]-2-oxoethyl] 2-(ethoxymethoxy)acetate |
| SMILES | CCOCOCC(=O)OCC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@]34O[C@H]4C[C@]12C |
| InChI | InChI=1S/C26H36O7/c1-4-30-15-31-14-23(29)32-13-21(28)20-8-7-18-19-6-5-16-11-17(27)9-10-25(16,3)26(19)22(33-26)12-24(18,20)2/h11,18-20,22H,4-10,12-15H2,1-3H3/t18-,19-,20+,22-,24-,25-,26+/m0/s1 |
| InChIKey | RYWRPGHLRIHPOO-VIIYAQQKSA-N |
| XLogP | 3.39 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|