C31H46O5S — CID 57050514
[2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-7-propanoylsulfanyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] heptanoate (PubChem CID 57050514) has the molecular formula C31H46O5S and a molecular weight of 530.77 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-7-propanoylsulfanyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] heptanoate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-7-propanoylsulfanyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] heptanoate |
|---|---|
| PubChem CID | 57050514 |
| Molecular Formula | C31H46O5S |
| Molecular Weight | 530.77 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-7-propanoylsulfanyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] heptanoate |
| SMILES | CCCCCCC(=O)OCC(=O)[C@H]1CC[C@H]2[C@@H]3C(SC(=O)CC)CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H46O5S/c1-5-7-8-9-10-27(34)36-19-25(33)22-11-12-23-29-24(14-16-31(22,23)4)30(3)15-13-21(32)17-20(30)18-26(29)37-28(35)6-2/h17,22-24,26,29H,5-16,18-19H2,1-4H3/t22-,23+,24+,26?,29+,30+,31-/m1/s1 |
| InChIKey | XUIRFPVXLFWBHK-CDUQOWBVSA-N |
| XLogP | 6.87 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.77 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|