C28H40O5S — CID 87773398
[2-[(8S,9S,10R,13S,14S,17S)-2-acetylsulfanyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] pentanoate (PubChem CID 87773398) has the molecular formula C28H40O5S and a molecular weight of 488.69 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17S)-2-acetylsulfanyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] pentanoate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17S)-2-acetylsulfanyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] pentanoate |
|---|---|
| PubChem CID | 87773398 |
| Molecular Formula | C28H40O5S |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17S)-2-acetylsulfanyl-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] pentanoate |
| SMILES | CCCCC(=O)OCC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C(SC(C)=O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H40O5S/c1-5-6-7-26(32)33-16-24(31)22-11-10-20-19-9-8-18-14-23(30)25(34-17(2)29)15-28(18,4)21(19)12-13-27(20,22)3/h14,19-22,25H,5-13,15-16H2,1-4H3/t19-,20-,21-,22+,25?,27-,28-/m0/s1 |
| InChIKey | MBFYHCAILNIPMQ-FGDPULKMSA-N |
| XLogP | 5.70 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|