C28H42O4S — CID 57215722
S-[(8S,9S,10R,13S,14S,17S)-17-(2-butoxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] propanethioate (PubChem CID 57215722) has the molecular formula C28H42O4S and a molecular weight of 474.71 g/mol. Its IUPAC name is S-[(8S,9S,10R,13S,14S,17S)-17-(2-butoxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] propanethioate.
| Compound Name | S-[(8S,9S,10R,13S,14S,17S)-17-(2-butoxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] propanethioate |
|---|---|
| PubChem CID | 57215722 |
| Molecular Formula | C28H42O4S |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | S-[(8S,9S,10R,13S,14S,17S)-17-(2-butoxyacetyl)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] propanethioate |
| SMILES | CCCCOCC(=O)[C@H]1CC[C@H]2[C@@H]3C(SC(=O)CC)CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H42O4S/c1-5-7-14-32-17-23(30)20-8-9-21-26-22(11-13-28(20,21)4)27(3)12-10-19(29)15-18(27)16-24(26)33-25(31)6-2/h15,20-22,24,26H,5-14,16-17H2,1-4H3/t20-,21+,22+,24?,26+,27+,28-/m1/s1 |
| InChIKey | YGXMGRGQFMEUQV-FSBSCBQNSA-N |
| XLogP | 6.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|