About 6-ethyloctan-3-yl 2-thiophen-2-ylacetate
6-ethyloctan-3-yl 2-thiophen-2-ylacetate (PubChem CID 566215) has the molecular formula C16H26O2S
and a molecular weight of 282.45 g/mol. Its IUPAC name is 6-ethyloctan-3-yl 2-thiophen-2-ylacetate.
Molecular Properties
| Compound Name | 6-ethyloctan-3-yl 2-thiophen-2-ylacetate |
| PubChem CID | 566215 |
| Molecular Formula | C16H26O2S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 6-ethyloctan-3-yl 2-thiophen-2-ylacetate |
| SMILES | CCC(CC)CCC(CC)OC(=O)Cc1cccs1 |
| InChI | InChI=1S/C16H26O2S/c1-4-13(5-2)9-10-14(6-3)18-16(17)12-15-8-7-11-19-15/h7-8,11,13-14H,4-6,9-10,12H2,1-3H3 |
| InChIKey | LMKZLFXOKVHCCP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyloctan-3-yl 2-thiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyloctan-3-yl 2-thiophen-2-ylacetate?
The IUPAC name of 6-ethyloctan-3-yl 2-thiophen-2-ylacetate (CID 566215) is 6-ethyloctan-3-yl 2-thiophen-2-ylacetate.
What is the SMILES notation for 6-ethyloctan-3-yl 2-thiophen-2-ylacetate?
The canonical SMILES for 6-ethyloctan-3-yl 2-thiophen-2-ylacetate is CCC(CC)CCC(CC)OC(=O)Cc1cccs1.
What is the InChIKey of 6-ethyloctan-3-yl 2-thiophen-2-ylacetate?
The InChIKey is LMKZLFXOKVHCCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2S/c1-4-13(5-2)9-10-14(6-3)18-16(17)12-15-8-7-11-19-15/h7-8,11,13-14H,4-6,9-10,12H2,1-3H3.
What are the key properties of 6-ethyloctan-3-yl 2-thiophen-2-ylacetate?
6-ethyloctan-3-yl 2-thiophen-2-ylacetate has a molecular weight of 282.45 g/mol, XLogP of 4.83, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyloctan-3-yl 2-thiophen-2-ylacetate is sourced from PubChem (CID 566215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).