About [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate
[(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate (PubChem CID 7122425) has the molecular formula C24H24O3S
and a molecular weight of 392.52 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate.
Molecular Properties
| Compound Name | [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate |
| PubChem CID | 7122425 |
| Molecular Formula | C24H24O3S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate |
| SMILES | CCCC[C@H](OC(=O)Cc1cccs1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24O3S/c1-2-3-11-22(27-23(25)17-21-10-7-16-28-21)24(26)20-14-12-19(13-15-20)18-8-5-4-6-9-18/h4-10,12-16,22H,2-3,11,17H2,1H3/t22-/m0/s1 |
| InChIKey | TUWOGNUXDOWESH-QFIPXVFZSA-N |
| XLogP | 5.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate?
The IUPAC name of [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate (CID 7122425) is [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate.
What is the SMILES notation for [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate?
The canonical SMILES for [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate is CCCC[C@H](OC(=O)Cc1cccs1)C(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate?
The InChIKey is TUWOGNUXDOWESH-QFIPXVFZSA-N. The full InChI is InChI=1S/C24H24O3S/c1-2-3-11-22(27-23(25)17-21-10-7-16-28-21)24(26)20-14-12-19(13-15-20)18-8-5-4-6-9-18/h4-10,12-16,22H,2-3,11,17H2,1H3/t22-/m0/s1.
What are the key properties of [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate?
[(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate has a molecular weight of 392.52 g/mol, XLogP of 5.94, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-oxo-1-(4-phenylphenyl)hexan-2-yl] 2-thiophen-2-ylacetate is sourced from PubChem (CID 7122425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).