C28H37NO2 — CID 56623263
9-benzylimino-3-hexyl-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-ol (PubChem CID 56623263) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is 9-benzylimino-3-hexyl-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-ol.
| Compound Name | 9-benzylimino-3-hexyl-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 56623263 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | 9-benzylimino-3-hexyl-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-ol |
| SMILES | CCCCCCc1cc(O)c2c(c1)OC(C)(C)C1CC/C(=N\Cc3ccccc3)CC21 |
| InChI | InChI=1S/C28H37NO2/c1-4-5-6-8-13-21-16-25(30)27-23-18-22(29-19-20-11-9-7-10-12-20)14-15-24(23)28(2,3)31-26(27)17-21/h7,9-12,16-17,23-24,30H,4-6,8,13-15,18-19H2,1-3H3/b29-22+ |
| InChIKey | QBZZAQHNASDDEY-QUPMIFSKSA-N |
| XLogP | 7.21 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|