C21H30O2 — CID 46843661
(6aR,10aR)-10,10a-dideuterio-6,6-dimethyl-3-pentyl-9-(trideuteriomethyl)-7,8-dihydro-6aH-benzo[c]chromen-1-ol (PubChem CID 46843661) has the molecular formula C21H30O2 and a molecular weight of 319.50 g/mol. Its IUPAC name is (6aR,10aR)-10,10a-dideuterio-6,6-dimethyl-3-pentyl-9-(trideuteriomethyl)-7,8-dihydro-6aH-benzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-10,10a-dideuterio-6,6-dimethyl-3-pentyl-9-(trideuteriomethyl)-7,8-dihydro-6aH-benzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 46843661 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | (6aR,10aR)-10,10a-dideuterio-6,6-dimethyl-3-pentyl-9-(trideuteriomethyl)-7,8-dihydro-6aH-benzo[c]chromen-1-ol |
| SMILES | [2H]C1=C(C([2H])([2H])[2H])CC[C@H]2C(C)(C)Oc3cc(CCCCC)cc(O)c3[C@]12[2H] |
| InChI | InChI=1S/C21H30O2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15/h11-13,16-17,22H,5-10H2,1-4H3/t16-,17-/m1/s1/i2D3,11D,16D |
| InChIKey | CYQFCXCEBYINGO-QIBPIVJMSA-N |
| XLogP | 5.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|