C28H42O6 — CID 56623712
(6S,8R,9S,10R,13S,14S,16R,17R)-17-(ethoxymethoxy)-6-ethyl-17-(2-hydroxyacetyl)-16-(2-hydroxyethyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 56623712) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is (6S,8R,9S,10R,13S,14S,16R,17R)-17-(ethoxymethoxy)-6-ethyl-17-(2-hydroxyacetyl)-16-(2-hydroxyethyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8R,9S,10R,13S,14S,16R,17R)-17-(ethoxymethoxy)-6-ethyl-17-(2-hydroxyacetyl)-16-(2-hydroxyethyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56623712 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (6S,8R,9S,10R,13S,14S,16R,17R)-17-(ethoxymethoxy)-6-ethyl-17-(2-hydroxyacetyl)-16-(2-hydroxyethyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCOCO[C@]1(C(=O)CO)[C@@H](CCO)C[C@H]2[C@@H]3C[C@H](CC)C4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H42O6/c1-5-18-13-21-22(26(3)10-7-20(31)15-23(18)26)8-11-27(4)24(21)14-19(9-12-29)28(27,25(32)16-30)34-17-33-6-2/h7,10,15,18-19,21-22,24,29-30H,5-6,8-9,11-14,16-17H2,1-4H3/t18-,19-,21+,22-,24-,26+,27-,28-/m0/s1 |
| InChIKey | ABGBSKMNLDSQPL-COUJOBLRSA-N |
| XLogP | 3.85 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|