C26H38O6 — CID 56635108
(6S,8R,9S,10R,13S,14S,16S,17R)-17-(2-hydroxyacetyl)-17-(2-hydroxyethoxymethoxy)-6,10,13,16-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 56635108) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is (6S,8R,9S,10R,13S,14S,16S,17R)-17-(2-hydroxyacetyl)-17-(2-hydroxyethoxymethoxy)-6,10,13,16-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8R,9S,10R,13S,14S,16S,17R)-17-(2-hydroxyacetyl)-17-(2-hydroxyethoxymethoxy)-6,10,13,16-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 56635108 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (6S,8R,9S,10R,13S,14S,16S,17R)-17-(2-hydroxyacetyl)-17-(2-hydroxyethoxymethoxy)-6,10,13,16-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H]1C[C@@H]2[C@H](CC[C@@]3(C)[C@H]2C[C@H](C)[C@]3(OCOCCO)C(=O)CO)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C26H38O6/c1-16-11-19-20(24(3)7-5-18(29)13-21(16)24)6-8-25(4)22(19)12-17(2)26(25,23(30)14-28)32-15-31-10-9-27/h5,7,13,16-17,19-20,22,27-28H,6,8-12,14-15H2,1-4H3/t16-,17-,19+,20-,22-,24+,25-,26-/m0/s1 |
| InChIKey | ONVSXQRYHKOYOT-HFOVECCFSA-N |
| XLogP | 3.07 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|