C10H11N3O6 — CID 56629425
2-(5-methoxycarbonyl-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)acetic acid (PubChem CID 56629425) has the molecular formula C10H11N3O6 and a molecular weight of 269.21 g/mol. Its IUPAC name is 2-(5-methoxycarbonyl-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)acetic acid.
| Compound Name | 2-(5-methoxycarbonyl-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)acetic acid |
|---|---|
| PubChem CID | 56629425 |
| Molecular Formula | C10H11N3O6 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-(5-methoxycarbonyl-1,3-dioxo-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)acetic acid |
| SMILES | COC(=O)C1C=CCn2c(=O)n(CC(=O)O)c(=O)n21 |
| InChI | InChI=1S/C10H11N3O6/c1-19-8(16)6-3-2-4-12-9(17)11(5-7(14)15)10(18)13(6)12/h2-3,6H,4-5H2,1H3,(H,14,15) |
| InChIKey | BSJOXXLNWSYRMF-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|