C14H27NOS2 — CID 56631173
S-(thiiran-2-ylmethyl) N,N-bis(3-methylbutyl)carbamothioate (PubChem CID 56631173) has the molecular formula C14H27NOS2 and a molecular weight of 289.51 g/mol. Its IUPAC name is S-(thiiran-2-ylmethyl) N,N-bis(3-methylbutyl)carbamothioate.
| Compound Name | S-(thiiran-2-ylmethyl) N,N-bis(3-methylbutyl)carbamothioate |
|---|---|
| PubChem CID | 56631173 |
| Molecular Formula | C14H27NOS2 |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | S-(thiiran-2-ylmethyl) N,N-bis(3-methylbutyl)carbamothioate |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)SCC1CS1 |
| InChI | InChI=1S/C14H27NOS2/c1-11(2)5-7-15(8-6-12(3)4)14(16)18-10-13-9-17-13/h11-13H,5-10H2,1-4H3 |
| InChIKey | SXHXYWJVGJDUJJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|