C8H13N2O3PS2 — CID 56631554
(6-ethoxy-2-methylpyrimidin-4-yl)methylsulfanyl-dihydroxy-sulfanylidene-λ5-phosphane (PubChem CID 56631554) has the molecular formula C8H13N2O3PS2 and a molecular weight of 280.31 g/mol. Its IUPAC name is (6-ethoxy-2-methylpyrimidin-4-yl)methylsulfanyl-dihydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | (6-ethoxy-2-methylpyrimidin-4-yl)methylsulfanyl-dihydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 56631554 |
| Molecular Formula | C8H13N2O3PS2 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | (6-ethoxy-2-methylpyrimidin-4-yl)methylsulfanyl-dihydroxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOc1cc(CSP(O)(O)=S)nc(C)n1 |
| InChI | InChI=1S/C8H13N2O3PS2/c1-3-13-8-4-7(9-6(2)10-8)5-16-14(11,12)15/h4H,3,5H2,1-2H3,(H2,11,12,15) |
| InChIKey | QYBRUQFBIBXXCO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|