C13H23N2O4PS2 — CID 88699769
(2,6-diethoxypyrimidin-4-yl)methoxy-methoxy-propylsulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 88699769) has the molecular formula C13H23N2O4PS2 and a molecular weight of 366.45 g/mol. Its IUPAC name is (2,6-diethoxypyrimidin-4-yl)methoxy-methoxy-propylsulfanyl-sulfanylidene-λ5-phosphane.
| Compound Name | (2,6-diethoxypyrimidin-4-yl)methoxy-methoxy-propylsulfanyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 88699769 |
| Molecular Formula | C13H23N2O4PS2 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2,6-diethoxypyrimidin-4-yl)methoxy-methoxy-propylsulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CCCS[P@@](=S)(OC)OCc1cc(OCC)nc(OCC)n1 |
| InChI | InChI=1S/C13H23N2O4PS2/c1-5-8-22-20(21,16-4)19-10-11-9-12(17-6-2)15-13(14-11)18-7-3/h9H,5-8,10H2,1-4H3/t20-/m0/s1 |
| InChIKey | VVURWEWDZSKSDT-FQEVSTJZSA-N |
| XLogP | 3.80 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|