C14H25N2O3PS3 — CID 57162728
(2,6-diethoxypyrimidin-4-yl)methylsulfanyl-ethoxy-propylsulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 57162728) has the molecular formula C14H25N2O3PS3 and a molecular weight of 396.54 g/mol. Its IUPAC name is (2,6-diethoxypyrimidin-4-yl)methylsulfanyl-ethoxy-propylsulfanyl-sulfanylidene-λ5-phosphane.
| Compound Name | (2,6-diethoxypyrimidin-4-yl)methylsulfanyl-ethoxy-propylsulfanyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 57162728 |
| Molecular Formula | C14H25N2O3PS3 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | (2,6-diethoxypyrimidin-4-yl)methylsulfanyl-ethoxy-propylsulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CCCSP(=S)(OCC)SCc1cc(OCC)nc(OCC)n1 |
| InChI | InChI=1S/C14H25N2O3PS3/c1-5-9-22-20(21,19-8-4)23-11-12-10-13(17-6-2)16-14(15-12)18-7-3/h10H,5-9,11H2,1-4H3 |
| InChIKey | HNJUSDLVWBBSBG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|