C47H59F3O7 — CID 56631892
[2-[(2R)-1,1,1-trifluorooctan-2-yl]oxycarbonyl-1,2,3,4-tetrahydronaphthalen-1-yl] 6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate (PubChem CID 56631892) has the molecular formula C47H59F3O7 and a molecular weight of 792.98 g/mol. Its IUPAC name is [2-[(2R)-1,1,1-trifluorooctan-2-yl]oxycarbonyl-1,2,3,4-tetrahydronaphthalen-1-yl] 6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate.
| Compound Name | [2-[(2R)-1,1,1-trifluorooctan-2-yl]oxycarbonyl-1,2,3,4-tetrahydronaphthalen-1-yl] 6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 56631892 |
| Molecular Formula | C47H59F3O7 |
| Molecular Weight | 792.98 g/mol |
| Exact Mass | 792.42 |
| IUPAC Name | [2-[(2R)-1,1,1-trifluorooctan-2-yl]oxycarbonyl-1,2,3,4-tetrahydronaphthalen-1-yl] 6-(4-decoxybenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)OC2CCc3cc(C(=O)OC4c5ccccc5CCC4C(=O)O[C@H](CCCCCC)C(F)(F)F)ccc3C2)cc1 |
| InChI | InChI=1S/C47H59F3O7/c1-3-5-7-9-10-11-12-16-30-54-38-26-22-34(23-27-38)44(51)55-39-28-24-35-31-37(21-20-36(35)32-39)45(52)57-43-40-18-15-14-17-33(40)25-29-41(43)46(53)56-42(47(48,49)50)19-13-8-6-4-2/h14-15,17-18,20-23,26-27,31,39,41-43H,3-13,16,19,24-25,28-30,32H2,1-2H3/t39?,41?,42-,43?/m1/s1 |
| InChIKey | SVTMQSMDLMWGIU-VWQKKGMRSA-N |
| XLogP | 11.83 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.98 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|