About ethyl 2H-pyran-5-carboxylate
ethyl 2H-pyran-5-carboxylate (PubChem CID 56632692) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is ethyl 2H-pyran-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2H-pyran-5-carboxylate |
| PubChem CID | 56632692 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | ethyl 2H-pyran-5-carboxylate |
| SMILES | CCOC(=O)C1=COCC=C1 |
| InChI | InChI=1S/C8H10O3/c1-2-11-8(9)7-4-3-5-10-6-7/h3-4,6H,2,5H2,1H3 |
| InChIKey | PJHIQNPFEHZYCG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2H-pyran-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2H-pyran-5-carboxylate?
The IUPAC name of ethyl 2H-pyran-5-carboxylate (CID 56632692) is ethyl 2H-pyran-5-carboxylate.
What is the SMILES notation for ethyl 2H-pyran-5-carboxylate?
The canonical SMILES for ethyl 2H-pyran-5-carboxylate is CCOC(=O)C1=COCC=C1.
What is the InChIKey of ethyl 2H-pyran-5-carboxylate?
The InChIKey is PJHIQNPFEHZYCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-2-11-8(9)7-4-3-5-10-6-7/h3-4,6H,2,5H2,1H3.
What are the key properties of ethyl 2H-pyran-5-carboxylate?
ethyl 2H-pyran-5-carboxylate has a molecular weight of 154.16 g/mol, XLogP of 1.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2H-pyran-5-carboxylate is sourced from PubChem (CID 56632692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).