C18H29FO4 — CID 56634178
1-[(1'R,2'R,3'aR,6'aS)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4-fluorooctan-1-one (PubChem CID 56634178) has the molecular formula C18H29FO4 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-[(1'R,2'R,3'aR,6'aS)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4-fluorooctan-1-one.
| Compound Name | 1-[(1'R,2'R,3'aR,6'aS)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4-fluorooctan-1-one |
|---|---|
| PubChem CID | 56634178 |
| Molecular Formula | C18H29FO4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-[(1'R,2'R,3'aR,6'aS)-2'-hydroxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-4-fluorooctan-1-one |
| SMILES | CCCCC(F)CCC(=O)[C@@H]1[C@H]2CC3(C[C@H]2C[C@H]1O)OCCO3 |
| InChI | InChI=1S/C18H29FO4/c1-2-3-4-13(19)5-6-15(20)17-14-11-18(22-7-8-23-18)10-12(14)9-16(17)21/h12-14,16-17,21H,2-11H2,1H3/t12-,13?,14+,16-,17+/m1/s1 |
| InChIKey | XNRXREFUFNSWKX-JVODVQKZSA-N |
| XLogP | 3.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |