C19H20Cl2O — CID 56634500
3,5-dichloro-1,7-diphenylheptan-4-one (PubChem CID 56634500) has the molecular formula C19H20Cl2O and a molecular weight of 335.27 g/mol. Its IUPAC name is 3,5-dichloro-1,7-diphenylheptan-4-one.
| Compound Name | 3,5-dichloro-1,7-diphenylheptan-4-one |
|---|---|
| PubChem CID | 56634500 |
| Molecular Formula | C19H20Cl2O |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3,5-dichloro-1,7-diphenylheptan-4-one |
| SMILES | O=C(C(Cl)CCc1ccccc1)C(Cl)CCc1ccccc1 |
| InChI | InChI=1S/C19H20Cl2O/c20-17(13-11-15-7-3-1-4-8-15)19(22)18(21)14-12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 |
| InChIKey | MKFZBANYYHZIGG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|