C10H12Cl2 — CID 129394752
[(3R)-3,4-dichlorobutyl]benzene (PubChem CID 129394752) has the molecular formula C10H12Cl2 and a molecular weight of 203.11 g/mol. Its IUPAC name is [(3R)-3,4-dichlorobutyl]benzene.
| Compound Name | [(3R)-3,4-dichlorobutyl]benzene |
|---|---|
| PubChem CID | 129394752 |
| Molecular Formula | C10H12Cl2 |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | [(3R)-3,4-dichlorobutyl]benzene |
| SMILES | ClC[C@H](Cl)CCc1ccccc1 |
| InChI | InChI=1S/C10H12Cl2/c11-8-10(12)7-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2/t10-/m1/s1 |
| InChIKey | QDMYSPBSWPBQFU-SNVBAGLBSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|