C12H14Cl2 — CID 66808199
1-(3,4-dichlorobutyl)-2-ethenylbenzene (PubChem CID 66808199) has the molecular formula C12H14Cl2 and a molecular weight of 229.15 g/mol. Its IUPAC name is 1-(3,4-dichlorobutyl)-2-ethenylbenzene.
| Compound Name | 1-(3,4-dichlorobutyl)-2-ethenylbenzene |
|---|---|
| PubChem CID | 66808199 |
| Molecular Formula | C12H14Cl2 |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1-(3,4-dichlorobutyl)-2-ethenylbenzene |
| SMILES | C=Cc1ccccc1CCC(Cl)CCl |
| InChI | InChI=1S/C12H14Cl2/c1-2-10-5-3-4-6-11(10)7-8-12(14)9-13/h2-6,12H,1,7-9H2 |
| InChIKey | JYLPKTAGNQPFIZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|